/* jquery.nicescroll
-- version 3.5.4
-- copyright 2013-11-13 InuYaksa*2013
-- licensed under the MIT
--
-- http://areaaperta.com/nicescroll
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/
(function(factory) {
if (typeof define === 'function' && define.amd) {
// AMD. Register as anonymous module.
define(['jquery'], factory);
} else {
// Browser globals.
factory(jQuery);
}
}(function(jQuery) {
// globals
var domfocus = false;
var mousefocus = false;
var zoomactive = false;
var tabindexcounter = 5000;
var ascrailcounter = 2000;
var globalmaxzindex = 0;
var $ = jQuery; // sandbox
// http://stackoverflow.com/questions/2161159/get-script-path
function getScriptPath() {
var scripts = document.getElementsByTagName('script');
var path = scripts[scripts.length - 1].src.split('?')[0];
return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
}
// var scriptpath = getScriptPath();
var vendors = ['ms', 'moz', 'webkit', 'o'];
var setAnimationFrame = window.requestAnimationFrame || false;
var clearAnimationFrame = window.cancelAnimationFrame || false;
if (!setAnimationFrame) {
for (var vx in vendors) {
var v = vendors[vx];
if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'];
if (!clearAnimationFrame) clearAnimationFrame = window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'];
}
}
var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false;
var _globaloptions = {
zindex: "auto",
cursoropacitymin: 0,
cursoropacitymax: 1,
cursorcolor: "#424242",
cursorwidth: "5px",
cursorborder: "1px solid #fff",
cursorborderradius: "5px",
scrollspeed: 60,
mousescrollstep: 8 * 3,
touchbehavior: false,
hwacceleration: true,
usetransition: true,
boxzoom: false,
dblclickzoom: true,
gesturezoom: true,
grabcursorenabled: true,
autohidemode: true,
background: "",
iframeautoresize: true,
cursorminheight: 32,
preservenativescrolling: true,
railoffset: false,
bouncescroll: true,
spacebarenabled: true,
railpadding: {
top: 0,
right: 0,
left: 0,
bottom: 0
},
disableoutline: true,
horizrailenabled: true,
railalign: "right",
railvalign: "bottom",
enabletranslate3d: true,
enablemousewheel: true,
enablekeyboard: true,
smoothscroll: true,
sensitiverail: true,
enablemouselockapi: true,
// cursormaxheight:false,
cursorfixedheight: false,
directionlockdeadzone: 6,
hidecursordelay: 400,
nativeparentscrolling: true,
enablescrollonselection: true,
overflowx: true,
overflowy: true,
cursordragspeed: 0.3,
rtlmode: "auto",
cursordragontouch: false,
oneaxismousemode: "auto",
scriptpath: getScriptPath()
};
var browserdetected = false;
var getBrowserDetection = function() {
if (browserdetected) return browserdetected;
var domtest = document.createElement('DIV');
var d = {};
d.haspointerlock = "pointerLockElement" in document || "mozPointerLockElement" in document || "webkitPointerLockElement" in document;
d.isopera = ("opera" in window);
d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
d.isoperamini = (Object.prototype.toString.call(window.operamini) === "[object OperaMini]");
d.isie = (("all" in document) && ("attachEvent" in domtest) && !d.isopera);
d.isieold = (d.isie && !("msInterpolationMode" in domtest.style)); // IE6 and older
d.isie7 = d.isie && !d.isieold && (!("documentMode" in document) || (document.documentMode == 7));
d.isie8 = d.isie && ("documentMode" in document) && (document.documentMode == 8);
d.isie9 = d.isie && ("performance" in window) && (document.documentMode >= 9);
d.isie10 = d.isie && ("performance" in window) && (document.documentMode >= 10);
d.isie9mobile = /iemobile.9/i.test(navigator.userAgent); //wp 7.1 mango
if (d.isie9mobile) d.isie9 = false;
d.isie7mobile = (!d.isie9mobile && d.isie7) && /iemobile/i.test(navigator.userAgent); //wp 7.0
d.ismozilla = ("MozAppearance" in domtest.style);
d.iswebkit = ("WebkitAppearance" in domtest.style);
d.ischrome = ("chrome" in window);
d.ischrome22 = (d.ischrome && d.haspointerlock);
d.ischrome26 = (d.ischrome && ("transition" in domtest.style)); // issue with transform detection (maintain prefix)
d.cantouch = ("ontouchstart" in document.documentElement) || ("ontouchstart" in window); // detection for Chrome Touch Emulation
d.hasmstouch = (window.navigator.msPointerEnabled || false); // IE10+ pointer events
d.ismac = /^mac$/i.test(navigator.platform);
d.isios = (d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform));
d.isios4 = ((d.isios) && !("seal" in Object));
d.isandroid = (/android/i.test(navigator.userAgent));
d.trstyle = false;
d.hastransform = false;
d.hastranslate3d = false;
d.transitionstyle = false;
d.hastransition = false;
d.transitionend = false;
var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
for (var a = 0; a < check.length; a++) {
if (typeof domtest.style[check[a]] != "undefined") {
d.trstyle = check[a];
break;
}
}
d.hastransform = (d.trstyle != false);
if (d.hastransform) {
domtest.style[d.trstyle] = "translate3d(1px,2px,3px)";
d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]);
}
d.transitionstyle = false;
d.prefixstyle = '';
d.transitionend = false;
var check = ['transition', 'webkitTransition', 'MozTransition', 'OTransition', 'OTransition', 'msTransition', 'KhtmlTransition'];
var prefix = ['', '-webkit-', '-moz-', '-o-', '-o', '-ms-', '-khtml-'];
var evs = ['transitionend', 'webkitTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'msTransitionEnd', 'KhtmlTransitionEnd'];
for (var a = 0; a < check.length; a++) {
if (check[a] in domtest.style) {
d.transitionstyle = check[a];
d.prefixstyle = prefix[a];
d.transitionend = evs[a];
break;
}
}
if (d.ischrome26) { // use always prefix
d.prefixstyle = prefix[1];
}
d.hastransition = (d.transitionstyle);
function detectCursorGrab() {
var lst = ['-moz-grab', '-webkit-grab', 'grab'];
if ((d.ischrome && !d.ischrome22) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
for (var a = 0; a < lst.length; a++) {
var p = lst[a];
domtest.style['cursor'] = p;
if (domtest.style['cursor'] == p) return p;
}
return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize'; // thank you google for custom cursor!
}
d.cursorgrabvalue = detectCursorGrab();
d.hasmousecapture = ("setCapture" in domtest);
d.hasMutationObserver = (clsMutationObserver !== false);
domtest = null; //memory released
browserdetected = d;
return d;
};
var NiceScrollClass = function(myopt, me) {
var self = this;
this.version = '3.5.4';
this.name = 'nicescroll';
this.me = me;
this.opt = {
doc: $("body"),
win: false
};
$.extend(this.opt, _globaloptions);
// Options for internal use
this.opt.snapbackspeed = 80;
if (myopt || false) {
for (var a in self.opt) {
if (typeof myopt[a] != "undefined") self.opt[a] = myopt[a];
}
}
this.doc = self.opt.doc;
this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
this.ispage = /^BODY|HTML/.test((self.opt.win) ? self.opt.win[0].nodeName : this.doc[0].nodeName);
this.haswrapper = (self.opt.win !== false);
this.win = self.opt.win || (this.ispage ? $(window) : this.doc);
this.docscroll = (this.ispage && !this.haswrapper) ? $(window) : this.win;
this.body = $("body");
this.viewport = false;
this.isfixed = false;
this.iframe = false;
this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
this.forcescreen = false; //force to use screen position on events
this.canshowonmouseevent = (self.opt.autohidemode != "scroll");
// Events jump table
this.onmousedown = false;
this.onmouseup = false;
this.onmousemove = false;
this.onmousewheel = false;
this.onkeypress = false;
this.ongesturezoom = false;
this.onclick = false;
// Nicescroll custom events
this.onscrollstart = false;
this.onscrollend = false;
this.onscrollcancel = false;
this.onzoomin = false;
this.onzoomout = false;
// Let's start!
this.view = false;
this.page = false;
this.scroll = {
x: 0,
y: 0
};
this.scrollratio = {
x: 0,
y: 0
};
this.cursorheight = 20;
this.scrollvaluemax = 0;
this.isrtlmode = false; //(this.opt.rtlmode=="auto") ? (this.win.css("direction")=="rtl") : (this.opt.rtlmode===true);
// this.checkrtlmode = false;
this.scrollrunning = false;
this.scrollmom = false;
this.observer = false;
this.observerremover = false; // observer on parent for remove detection
do {
this.id = "ascrail" + (ascrailcounter++);
} while (document.getElementById(this.id));
this.rail = false;
this.cursor = false;
this.cursorfreezed = false;
this.selectiondrag = false;
this.zoom = false;
this.zoomactive = false;
this.hasfocus = false;
this.hasmousefocus = false;
this.visibility = true;
this.locked = false;
this.hidden = false; // rails always hidden
this.cursoractive = true; // user can interact with cursors
this.wheelprevented = false; //prevent mousewheel event
this.overflowx = self.opt.overflowx;
this.overflowy = self.opt.overflowy;
this.nativescrollingarea = false;
this.checkarea = 0;
this.events = []; // event list for unbind
this.saved = {};
this.delaylist = {};
this.synclist = {};
this.lastdeltax = 0;
this.lastdeltay = 0;
this.detected = getBrowserDetection();
var cap = $.extend({}, this.detected);
this.canhwscroll = (cap.hastransform && self.opt.hwacceleration);
this.ishwscroll = (this.canhwscroll && self.haswrapper);
this.istouchcapable = false; // desktop devices with touch screen support
//## Check Chrome desktop with touch support
if (cap.cantouch && cap.ischrome && !cap.isios && !cap.isandroid) {
this.istouchcapable = true;
cap.cantouch = false; // parse normal desktop events
}
//## Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
if (cap.cantouch && cap.ismozilla && !cap.isios && !cap.isandroid) {
this.istouchcapable = true;
cap.cantouch = false; // parse normal desktop events
}
//## disable MouseLock API on user request
if (!self.opt.enablemouselockapi) {
cap.hasmousecapture = false;
cap.haspointerlock = false;
}
this.delayed = function(name, fn, tm, lazy) {
var dd = self.delaylist[name];
var nw = (new Date()).getTime();
if (!lazy && dd && dd.tt) return false;
if (dd && dd.tt) clearTimeout(dd.tt);
if (dd && dd.last + tm > nw && !dd.tt) {
self.delaylist[name] = {
last: nw + tm,
tt: setTimeout(function() {
if (self || false) {
self.delaylist[name].tt = 0;
fn.call()
}
}, tm)
}
} else if (!dd || !dd.tt) {
self.delaylist[name] = {
last: nw,
tt: 0
};
setTimeout(function() {
fn.call();
}, 0);
}
};
this.debounced = function(name, fn, tm) {
var dd = self.delaylist[name];
var nw = (new Date()).getTime();
self.delaylist[name] = fn;
if (!dd) {
setTimeout(function() {
var fn = self.delaylist[name];
self.delaylist[name] = false;
fn.call();
}, tm);
}
};
var _onsync = false;
this.synched = function(name, fn) {
function requestSync() {
if (_onsync) return;
setAnimationFrame(function() {
_onsync = false;
for (name in self.synclist) {
var fn = self.synclist[name];
if (fn) fn.call(self);
self.synclist[name] = false;
}
});
_onsync = true;
};
self.synclist[name] = fn;
requestSync();
return name;
};
this.unsynched = function(name) {
if (self.synclist[name]) self.synclist[name] = false;
};
this.css = function(el, pars) { // save & set
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)]);
el.css(n, pars[n]);
}
};
this.scrollTop = function(val) {
return (typeof val == "undefined") ? self.getScrollTop() : self.setScrollTop(val);
};
this.scrollLeft = function(val) {
return (typeof val == "undefined") ? self.getScrollLeft() : self.setScrollLeft(val);
};
// derived by by Dan Pupius www.pupius.net
BezierClass = function(st, ed, spd, p1, p2, p3, p4) {
this.st = st;
this.ed = ed;
this.spd = spd;
this.p1 = p1 || 0;
this.p2 = p2 || 1;
this.p3 = p3 || 0;
this.p4 = p4 || 1;
this.ts = (new Date()).getTime();
this.df = this.ed - this.st;
};
BezierClass.prototype = {
B2: function(t) {
return 3 * t * t * (1 - t)
},
B3: function(t) {
return 3 * t * (1 - t) * (1 - t)
},
B4: function(t) {
return (1 - t) * (1 - t) * (1 - t)
},
getNow: function() {
var nw = (new Date()).getTime();
var pc = 1 - ((nw - this.ts) / this.spd);
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
return (pc < 0) ? this.ed : this.st + Math.round(this.df * bz);
},
update: function(ed, spd) {
this.st = this.getNow();
this.ed = ed;
this.spd = spd;
this.ts = (new Date()).getTime();
this.df = this.ed - this.st;
return this;
}
};
if (this.ishwscroll) {
// hw accelerated scroll
this.doc.translate = {
x: 0,
y: 0,
tx: "0px",
ty: "0px"
};
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
//derived from http://stackoverflow.com/questions/11236090/
function getMatrixValues() {
var tr = self.doc.css(cap.trstyle);
if (tr && (tr.substr(0, 6) == "matrix")) {
return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
}
return false;
}
this.getScrollTop = function(last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
}
return self.doc.translate.y;
};
this.getScrollLeft = function(last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
}
return self.doc.translate.x;
};
if (document.createEvent) {
this.notifyScrollEvent = function(el) {
var e = document.createEvent("UIEvents");
e.initUIEvent("scroll", false, true, window, 1);
el.dispatchEvent(e);
};
} else if (document.fireEvent) {
this.notifyScrollEvent = function(el) {
var e = document.createEventObject();
el.fireEvent("onscroll");
e.cancelBubble = true;
};
} else {
this.notifyScrollEvent = function(el, add) {}; //NOPE
}
var cxscrollleft = -1; //(this.isrtlmode) ? 1 : -1;
if (cap.hastranslate3d && self.opt.enabletranslate3d) {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0px)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
} else {
this.setScrollTop = function(val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function(val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
}
} else {
// native scroll
this.getScrollTop = function() {
return self.docscroll.scrollTop();
};
this.setScrollTop = function(val) {
return self.docscroll.scrollTop(val);
};
this.getScrollLeft = function() {
return self.docscroll.scrollLeft();
};
this.setScrollLeft = function(val) {
return self.docscroll.scrollLeft(val);
};
}
this.getTarget = function(e) {
if (!e) return false;
if (e.target) return e.target;
if (e.srcElement) return e.srcElement;
return false;
};
this.hasParent = function(e, id) {
if (!e) return false;
var el = e.target || e.srcElement || e || false;
while (el && el.id != id) {
el = el.parentNode || false;
}
return (el !== false);
};
function getZIndex() {
var dom = self.win;
if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false;
var zi = dom.css('zIndex');
if (!isNaN(zi) && zi != 0) return parseInt(zi);
dom = dom.parent();
}
return false;
};
//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
var _convertBorderWidth = {
"thin": 1,
"medium": 3,
"thick": 5
};
function getWidthToPixel(dom, prop, chkheight) {
var wd = dom.css(prop);
var px = parseFloat(wd);
if (isNaN(px)) {
px = _convertBorderWidth[wd] || 0;
var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
if (self.isie8 && px) px += 1;
return (brd) ? px : 0;
}
return px;
};
this.getOffset = function() {
if (self.isfixed) return {
top: parseFloat(self.win.css('top')),
left: parseFloat(self.win.css('left'))
};
if (!self.viewport) return self.win.offset();
var ww = self.win.offset();
var vp = self.viewport.offset();
return {
top: ww.top - vp.top + self.viewport.scrollTop(),
left: ww.left - vp.left + self.viewport.scrollLeft()
};
};
this.updateScrollBar = function(len) {
if (self.ishwscroll) {
self.rail.css({
height: self.win.innerHeight()
});
if (self.railh) self.railh.css({
width: self.win.innerWidth()
});
} else {
var wpos = self.getOffset();
var pos = {
top: wpos.top,
left: wpos.left
};
pos.top += getWidthToPixel(self.win, 'border-top-width', true);
var brd = (self.win.outerWidth() - self.win.innerWidth()) / 2;
pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
var off = self.opt.railoffset;
if (off) {
if (off.top) pos.top += off.top;
if (self.rail.align && off.left) pos.left += off.left;
}
if (!self.locked) self.rail.css({
top: pos.top,
left: pos.left,
height: (len) ? len.h : self.win.innerHeight()
});
if (self.zoom) {
self.zoom.css({
top: pos.top + 1,
left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
});
}
if (self.railh && !self.locked) {
var pos = {
top: wpos.top,
left: wpos.left
};
var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
self.railh.css({
top: y,
left: x,
width: self.railh.width
});
}
}
};
this.doRailClick = function(e, dbl, hr) {
var fn, pg, cur, pos;
// if (self.rail.drag&&self.rail.drag.pt!=1) return;
if (self.locked) return;
// if (self.rail.drag) return;
// self.cancelScroll();
self.cancelEvent(e);
if (dbl) {
fn = (hr) ? self.doScrollLeft : self.doScrollTop;
cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
fn(cur);
} else {
fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
cur = (hr) ? self.scroll.x : self.scroll.y;
pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
pg = (hr) ? self.view.w : self.view.h;
(cur >= pos) ? fn(pg) : fn(-pg);
}
};
self.hasanimationframe = (setAnimationFrame);
self.hascancelanimationframe = (clearAnimationFrame);
if (!self.hasanimationframe) {
setAnimationFrame = function(fn) {
return setTimeout(fn, 15 - Math.floor((+new Date) / 1000) % 16)
}; // 1000/60)};
clearAnimationFrame = clearInterval;
} else if (!self.hascancelanimationframe) clearAnimationFrame = function() {
self.cancelAnimationFrame = true
};
this.init = function() {
self.saved.css = [];
if (cap.isie7mobile) return true; // SORRY, DO NOT WORK!
if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
if (cap.hasmstouch) self.css((self.ispage) ? $("html") : self.win, {
'-ms-touch-action': 'none'
});
self.zindex = "auto";
if (!self.ispage && self.opt.zindex == "auto") {
self.zindex = getZIndex() || "auto";
} else {
self.zindex = self.opt.zindex;
}
if (!self.ispage && self.zindex != "auto") {
if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex;
}
if (self.isie && self.zindex == 0 && self.opt.zindex == "auto") { // fix IE auto == 0
self.zindex = "auto";
}
/*
self.ispage = true;
self.haswrapper = true;
// self.win = $(window);
self.docscroll = $("body");
// self.doc = $("body");
*/
if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
var cont = self.docscroll;
if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
if (!cap.isie9mobile) self.css(cont, {
'overflow-y': 'hidden'
});
if (self.ispage && cap.isie7) {
if (self.doc[0].nodeName == 'BODY') self.css($("html"), {
'overflow-y': 'hidden'
}); //IE7 double scrollbar issue
else if (self.doc[0].nodeName == 'HTML') self.css($("body"), {
'overflow-y': 'hidden'
}); //IE7 double scrollbar issue
}
if (cap.isios && !self.ispage && !self.haswrapper) self.css($("body"), {
"-webkit-overflow-scrolling": "touch"
}); //force hw acceleration
var cursor = $(document.createElement('div'));
cursor.css({
position: "relative",
top: 0,
"float": "right",
width: self.opt.cursorwidth,
height: "0px",
'background-color': self.opt.cursorcolor,
border: self.opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
});
cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight());
self.cursor = cursor;
var rail = $(document.createElement('div'));
rail.attr('id', self.id);
rail.addClass('nicescroll-rails');
var v, a, kp = ["left", "right"]; //"top","bottom"
for (var n in kp) {
a = kp[n];
v = self.opt.railpadding[a];
(v) ? rail.css("padding-" + a, v + "px") : self.opt.railpadding[a] = 0;
}
rail.append(cursor);
rail.width = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth()) + self.opt.railpadding['left'] + self.opt.railpadding['right'];
rail.css({
width: rail.width + "px",
'zIndex': self.zindex,
"background": self.opt.background,
cursor: "default"
});
rail.visibility = true;
rail.scrollable = true;
rail.align = (self.opt.railalign == "left") ? 0 : 1;
self.rail = rail;
self.rail.drag = false;
var zoom = false;
if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
zoom = document.createElement('div');
self.bind(zoom, "click", self.doZoom);
self.zoom = $(zoom);
self.zoom.css({
"cursor": "pointer",
'z-index': self.zindex,
// 'backgroundImage': 'url(' + self.opt.scriptpath + 'zoomico.png)',
'height': 18,
'width': 18,
'backgroundPosition': '0px 0px'
});
if (self.opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
if (cap.cantouch && self.opt.gesturezoom) {
self.ongesturezoom = function(e) {
if (e.scale > 1.5) self.doZoomIn(e);
if (e.scale < 0.8) self.doZoomOut(e);
return self.cancelEvent(e);
};
self.bind(self.win, "gestureend", self.ongesturezoom);
}
}
// init HORIZ
self.railh = false;
if (self.opt.horizrailenabled) {
self.css(cont, {
'overflow-x': 'hidden'
});
var cursor = $(document.createElement('div'));
cursor.css({
position: "relative",
top: 0,
height: self.opt.cursorwidth,
width: "0px",
'background-color': self.opt.cursorcolor,
border: self.opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
});
cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth());
self.cursorh = cursor;
var railh = $(document.createElement('div'));
railh.attr('id', self.id + '-hr');
railh.addClass('nicescroll-rails');
railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight());
railh.css({
height: railh.height + "px",
'zIndex': self.zindex,
"background": self.opt.background
});
railh.append(cursor);
railh.visibility = true;
railh.scrollable = true;
railh.align = (self.opt.railvalign == "top") ? 0 : 1;
self.railh = railh;
self.railh.drag = false;
}
//
if (self.ispage) {
rail.css({
position: "fixed",
top: "0px",
height: "100%"
});
(rail.align) ? rail.css({
right: "0px"
}) : rail.css({
left: "0px"
});
self.body.append(rail);
if (self.railh) {
railh.css({
position: "fixed",
left: "0px",
width: "100%"
});
(railh.align) ? railh.css({
bottom: "0px"
}) : railh.css({
top: "0px"
});
self.body.append(railh);
}
} else {
if (self.ishwscroll) {
if (self.win.css('position') == 'static') self.css(self.win, {
'position': 'relative'
});
var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
if (self.zoom) {
self.zoom.css({
position: "absolute",
top: 1,
right: 0,
"margin-right": rail.width + 4
});
bd.append(self.zoom);
}
rail.css({
position: "absolute",
top: 0
});
(rail.align) ? rail.css({
right: 0
}) : rail.css({
left: 0
});
bd.append(rail);
if (railh) {
railh.css({
position: "absolute",
left: 0,
bottom: 0
});
(railh.align) ? railh.css({
bottom: 0
}) : railh.css({
top: 0
});
bd.append(railh);
}
} else {
self.isfixed = (self.win.css("position") == "fixed");
var rlpos = (self.isfixed) ? "fixed" : "absolute";
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
if (self.viewport) {
self.body = self.viewport;
if ((/fixed|relative|absolute/.test(self.viewport.css("position"))) == false) self.css(self.viewport, {
"position": "relative"
});
}
rail.css({
position: rlpos
});
if (self.zoom) self.zoom.css({
position: rlpos
});
self.updateScrollBar();
self.body.append(rail);
if (self.zoom) self.body.append(self.zoom);
if (self.railh) {
railh.css({
position: rlpos
});
self.body.append(railh);
}
}
if (cap.isios) self.css(self.win, {
'-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
'-webkit-touch-callout': 'none'
}); // prevent grey layer on click
if (cap.isie && self.opt.disableoutline) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
if (cap.iswebkit && self.opt.disableoutline) self.win.css({
"outline": "none"
});
// if (cap.isopera&&self.opt.disableoutline) self.win.css({"outline":"0"}); // Opera to test [TODO]
}
if (self.opt.autohidemode === false) {
self.autohidedom = false;
self.rail.css({
opacity: self.opt.cursoropacitymax
});
if (self.railh) self.railh.css({
opacity: self.opt.cursoropacitymax
});
} else if ((self.opt.autohidemode === true) || (self.opt.autohidemode === "leave")) {
self.autohidedom = $().add(self.rail);
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (self.opt.autohidemode == "scroll") {
self.autohidedom = $().add(self.rail);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
} else if (self.opt.autohidemode == "cursor") {
self.autohidedom = $().add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (self.opt.autohidemode == "hidden") {
self.autohidedom = false;
self.hide();
self.locked = false;
}
if (cap.isie9mobile) {
self.scrollmom = new ScrollMomentumClass2D(self);
/*
var trace = function(msg) {
var db = $("#debug");
if (isNaN(msg)&&(typeof msg != "string")) {
var x = [];
for(var a in msg) {
x.push(a+":"+msg[a]);
}
msg ="{"+x.join(",")+"}";
}
if (db.children().length>0) {
db.children().eq(0).before("
"+msg+"
");
} else {
db.append(""+msg+"
");
}
}
window.onerror = function(msg,url,ln) {
trace("ERR: "+msg+" at "+ln);
}
*/
self.onmangotouch = function(e) {
var py = self.getScrollTop();
var px = self.getScrollLeft();
if ((py == self.scrollmom.lastscrolly) && (px == self.scrollmom.lastscrollx)) return true;
// $("#debug").html('DRAG:'+py);
var dfy = py - self.mangotouch.sy;
var dfx = px - self.mangotouch.sx;
var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)));
if (df == 0) return;
var dry = (dfy < 0) ? -1 : 1;
var drx = (dfx < 0) ? -1 : 1;
var tm = +new Date();
if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy);
if (((tm - self.mangotouch.tm) > 80) || (self.mangotouch.dry != dry) || (self.mangotouch.drx != drx)) {
// trace('RESET+'+(tm-self.mangotouch.tm));
self.scrollmom.stop();
self.scrollmom.reset(px, py);
self.mangotouch.sy = py;
self.mangotouch.ly = py;
self.mangotouch.sx = px;
self.mangotouch.lx = px;
self.mangotouch.dry = dry;
self.mangotouch.drx = drx;
self.mangotouch.tm = tm;
} else {
self.scrollmom.stop();
self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy);
var gap = tm - self.mangotouch.tm;
self.mangotouch.tm = tm;
// trace('MOVE:'+df+" - "+gap);
var ds = Math.max(Math.abs(self.mangotouch.ly - py), Math.abs(self.mangotouch.lx - px));
self.mangotouch.ly = py;
self.mangotouch.lx = px;
if (ds > 2) {
self.mangotouch.lazy = setTimeout(function() {
// trace('END:'+ds+'+'+gap);
self.mangotouch.lazy = false;
self.mangotouch.dry = 0;
self.mangotouch.drx = 0;
self.mangotouch.tm = 0;
self.scrollmom.doMomentum(30);
}, 100);
}
}
};
var top = self.getScrollTop();
var lef = self.getScrollLeft();
self.mangotouch = {
sy: top,
ly: top,
dry: 0,
sx: lef,
lx: lef,
drx: 0,
lazy: false,
tm: 0
};
self.bind(self.docscroll, "scroll", self.onmangotouch);
} else {
if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
self.scrollmom = new ScrollMomentumClass2D(self);
self.ontouchstart = function(e) {
if (e.pointerType && e.pointerType != 2) return false;
self.hasmoving = false;
if (!self.locked) {
if (cap.hasmstouch) {
var tg = (e.target) ? e.target : false;
while (tg) {
var nc = $(tg).getNiceScroll();
if ((nc.length > 0) && (nc[0].me == self.me)) break;
if (nc.length > 0) return false;
if ((tg.nodeName == 'DIV') && (tg.id == self.id)) break;
tg = (tg.parentNode) ? tg.parentNode : false;
}
}
self.cancelScroll();
var tg = self.getTarget(e);
if (tg) {
var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
if (skp) return self.stopPropagation(e);
}
if (!("clientX" in e) && ("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
if (self.forcescreen) {
var le = e;
var e = {
"original": (e.original) ? e.original : e
};
e.clientX = le.screenX;
e.clientY = le.screenY;
}
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
st: self.getScrollTop(),
sl: self.getScrollLeft(),
pt: 2,
dl: false
};
if (self.ispage || !self.opt.directionlockdeadzone) {
self.rail.drag.dl = "f";
} else {
var view = {
w: $(window).width(),
h: $(window).height()
};
var page = {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
};
var maxh = Math.max(0, page.h - view.h);
var maxw = Math.max(0, page.w - view.w);
if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
else if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
else self.rail.drag.ck = false;
if (!self.rail.drag.ck) self.rail.drag.dl = "f";
}
if (self.opt.touchbehavior && self.isiframe && cap.isie) {
var wp = self.win.position();
self.rail.drag.x += wp.left;
self.rail.drag.y += wp.top;
}
self.hasmoving = false;
self.lastmouseup = false;
self.scrollmom.reset(e.clientX, e.clientY);
if (!cap.cantouch && !this.istouchcapable && !cap.hasmstouch) {
var ip = (tg) ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false;
if (!ip) {
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.opt.touchbehavior) {
if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
tg._onclick = tg.onclick;
tg.onclick = function(e) {
if (self.hasmoving) return false;
tg._onclick.call(this, e);
}
}
return self.cancelEvent(e);
}
return self.stopPropagation(e);
}
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
pc = {
"tg": tg,
"click": false
};
self.preventclick = pc;
}
}
}
};
self.ontouchend = function(e) {
if (e.pointerType && e.pointerType != 2) return false;
if (self.rail.drag && (self.rail.drag.pt == 2)) {
self.scrollmom.doMomentum();
self.rail.drag = false;
if (self.hasmoving) {
self.lastmouseup = true;
self.hideCursor();
if (cap.hasmousecapture) document.releaseCapture();
if (!cap.cantouch) return self.cancelEvent(e);
}
}
};
var moveneedoffset = (self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture);
self.ontouchmove = function(e, byiframe) {
if (e.pointerType && e.pointerType != 2) return false;
if (self.rail.drag && (self.rail.drag.pt == 2)) {
if (cap.cantouch && (typeof e.original == "undefined")) return true; // prevent ios "ghost" events by clickable elements
self.hasmoving = true;
if (self.preventclick && !self.preventclick.click) {
self.preventclick.click = self.preventclick.tg.onclick || false;
self.preventclick.tg.onclick = self.onpreventclick;
}
var ev = $.extend({
"original": e
}, e);
e = ev;
if (("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
if (self.forcescreen) {
var le = e;
var e = {
"original": (e.original) ? e.original : e
};
e.clientX = le.screenX;
e.clientY = le.screenY;
}
var ofx = ofy = 0;
if (moveneedoffset && !byiframe) {
var wp = self.win.position();
ofx = -wp.left;
ofy = -wp.top;
}
var fy = e.clientY + ofy;
var my = (fy - self.rail.drag.y);
var fx = e.clientX + ofx;
var mx = (fx - self.rail.drag.x);
var ny = self.rail.drag.st - my;
if (self.ishwscroll && self.opt.bouncescroll) {
if (ny < 0) {
ny = Math.round(ny / 2);
// fy = 0;
} else if (ny > self.page.maxh) {
ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
// fy = 0;
}
} else {
if (ny < 0) {
ny = 0;
fy = 0
}
if (ny > self.page.maxh) {
ny = self.page.maxh;
fy = 0
}
}
if (self.railh && self.railh.scrollable) {
var nx = self.rail.drag.sl - mx;; //(self.isrtlmode) ? mx-self.rail.drag.sl : self.rail.drag.sl-mx;
if (self.ishwscroll && self.opt.bouncescroll) {
if (nx < 0) {
nx = Math.round(nx / 2);
// fx = 0;
} else if (nx > self.page.maxw) {
nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
// fx = 0;
}
} else {
if (nx < 0) {
nx = 0;
fx = 0
}
if (nx > self.page.maxw) {
nx = self.page.maxw;
fx = 0
}
}
}
var grabbed = false;
if (self.rail.drag.dl) {
grabbed = true;
if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
} else {
var ay = Math.abs(my);
var ax = Math.abs(mx);
var dz = self.opt.directionlockdeadzone;
if (self.rail.drag.ck == "v") {
if (ay > dz && (ax <= (ay * 0.3))) {
self.rail.drag = false;
return true;
} else if (ax > dz) {
self.rail.drag.dl = "f";
$("body").scrollTop($("body").scrollTop()); // stop iOS native scrolling (when active javascript has blocked)
}
} else if (self.rail.drag.ck == "h") {
if (ax > dz && (ay <= (ax * 0.3))) {
self.rail.drag = false;
return true;
} else if (ay > dz) {
self.rail.drag.dl = "f";
$("body").scrollLeft($("body").scrollLeft()); // stop iOS native scrolling (when active javascript has blocked)
}
}
}
self.synched("touchmove", function() {
if (self.rail.drag && (self.rail.drag.pt == 2)) {
if (self.prepareTransition) self.prepareTransition(0);
if (self.rail.scrollable) self.setScrollTop(ny);
self.scrollmom.update(fx, fy);
if (self.railh && self.railh.scrollable) {
self.setScrollLeft(nx);
self.showCursor(ny, nx);
} else {
self.showCursor(ny);
}
if (cap.isie10) document.selection.clear();
}
});
if (cap.ischrome && self.istouchcapable) grabbed = false; //chrome touch emulation doesn't like!
if (grabbed) return self.cancelEvent(e);
}
};
}
self.onmousedown = function(e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 1) return;
if (self.locked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 1,
hr: ( !! hronly)
};
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved["csspointerevents"] = self.doc.css("pointer-events");
self.css(self.doc, {
"pointer-events": "none"
});
}
self.hasmoving = false;
return self.cancelEvent(e);
};
self.onmouseup = function(e) {
if (self.rail.drag) {
if (cap.hasmousecapture) document.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved["csspointerevents"]);
if (self.rail.drag.pt != 1) return;
self.rail.drag = false;
//if (!self.rail.active) self.hideCursor();
if (self.hasmoving) self.triggerScrollEnd(); // TODO - check &&!self.scrollrunning
return self.cancelEvent(e);
}
};
self.onmousemove = function(e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return;
if (cap.ischrome && e.which == 0) return self.onmouseup(e);
self.cursorfreezed = true;
self.hasmoving = true;
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
self.synched('mousemove', function() {
if (self.rail.drag && (self.rail.drag.pt == 1)) {
self.showCursor();
if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), self.opt.cursordragspeed);
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), self.opt.cursordragspeed);
}
});
return self.cancelEvent(e);
}
/*
else {
self.checkarea = true;
}
*/
};
if (cap.cantouch || self.opt.touchbehavior) {
self.onpreventclick = function(e) {
if (self.preventclick) {
self.preventclick.tg.onclick = self.preventclick.click;
self.preventclick = false;
return self.cancelEvent(e);
}
}
// self.onmousedown = self.ontouchstart;
// self.onmouseup = self.ontouchend;
// self.onmousemove = self.ontouchmove;
self.bind(self.win, "mousedown", self.ontouchstart); // control content dragging
self.onclick = (cap.isios) ? false : function(e) {
if (self.lastmouseup) {
self.lastmouseup = false;
return self.cancelEvent(e);
} else {
return true;
}
};
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
self.css((self.ispage) ? self.doc : self.win, {
'cursor': cap.cursorgrabvalue
});
self.css(self.rail, {
'cursor': cap.cursorgrabvalue
});
}
} else {
function checkSelectionScroll(e) {
if (!self.selectiondrag) return;
if (e) {
var ww = self.win.outerHeight();
var df = (e.pageY - self.selectiondrag.top);
if (df > 0 && df < ww) df = 0;
if (df >= ww) df -= ww;
self.selectiondrag.df = df;
}
if (self.selectiondrag.df == 0) return;
var rt = -Math.floor(self.selectiondrag.df / 6) * 2;
// self.doScrollTop(self.getScrollTop(true)+rt);
self.doScrollBy(rt);
self.debounced("doselectionscroll", function() {
checkSelectionScroll()
}, 50);
};
if ("getSelection" in document) { // A grade - Major browsers
self.hasTextSelected = function() {
return (document.getSelection().rangeCount > 0);
};
} else if ("selection" in document) { //IE9-
self.hasTextSelected = function() {
return (document.selection.type != "None");
};
} else {
self.hasTextSelected = function() { // no support
return false;
};
}
self.onselectionstart = function(e) {
if (self.ispage) return;
self.selectiondrag = self.win.offset();
};
self.onselectionend = function(e) {
self.selectiondrag = false;
};
self.onselectiondrag = function(e) {
if (!self.selectiondrag) return;
if (self.hasTextSelected()) self.debounced("selectionscroll", function() {
checkSelectionScroll(e)
}, 250);
};
}
if (cap.hasmstouch) {
self.css(self.rail, {
'-ms-touch-action': 'none'
});
self.css(self.cursor, {
'-ms-touch-action': 'none'
});
self.bind(self.win, "MSPointerDown", self.ontouchstart);
self.bind(document, "MSPointerUp", self.ontouchend);
self.bind(document, "MSPointerMove", self.ontouchmove);
self.bind(self.cursor, "MSGestureHold", function(e) {
e.preventDefault()
});
self.bind(self.cursor, "contextmenu", function(e) {
e.preventDefault()
});
}
if (this.istouchcapable) { //desktop with screen touch enabled
self.bind(self.win, "touchstart", self.ontouchstart);
self.bind(document, "touchend", self.ontouchend);
self.bind(document, "touchcancel", self.ontouchend);
self.bind(document, "touchmove", self.ontouchmove);
}
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
if (self.railh) {
self.bind(self.cursorh, "mousedown", function(e) {
self.onmousedown(e, true)
});
self.bind(self.cursorh, "mouseup", self.onmouseup);
/*
self.bind(self.cursorh,"mouseup",function(e){
if (self.rail.drag&&self.rail.drag.pt==2) return;
self.rail.drag = false;
self.hasmoving = false;
self.hideCursor();
if (cap.hasmousecapture) document.releaseCapture();
return self.cancelEvent(e);
});
*/
}
if (self.opt.cursordragontouch || !cap.cantouch && !self.opt.touchbehavior) {
self.rail.css({
"cursor": "default"
});
self.railh && self.railh.css({
"cursor": "default"
});
self.jqbind(self.rail, "mouseenter", function() {
if (!self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.rail, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
if (self.opt.sensitiverail) {
self.bind(self.rail, "click", function(e) {
self.doRailClick(e, false, false)
});
self.bind(self.rail, "dblclick", function(e) {
self.doRailClick(e, true, false)
});
self.bind(self.cursor, "click", function(e) {
self.cancelEvent(e)
});
self.bind(self.cursor, "dblclick", function(e) {
self.cancelEvent(e)
});
}
if (self.railh) {
self.jqbind(self.railh, "mouseenter", function() {
if (!self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.railh, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
if (self.opt.sensitiverail) {
self.bind(self.railh, "click", function(e) {
self.doRailClick(e, false, true)
});
self.bind(self.railh, "dblclick", function(e) {
self.doRailClick(e, true, true)
});
self.bind(self.cursorh, "click", function(e) {
self.cancelEvent(e)
});
self.bind(self.cursorh, "dblclick", function(e) {
self.cancelEvent(e)
});
}
}
}
if (!cap.cantouch && !self.opt.touchbehavior) {
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.onmouseup);
self.bind(document, "mousemove", self.onmousemove);
if (self.onclick) self.bind(document, "click", self.onclick);
if (!self.ispage && self.opt.enablescrollonselection) {
self.bind(self.win[0], "mousedown", self.onselectionstart);
self.bind(document, "mouseup", self.onselectionend);
self.bind(self.cursor, "mouseup", self.onselectionend);
if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
self.bind(document, "mousemove", self.onselectiondrag);
}
if (self.zoom) {
self.jqbind(self.zoom, "mouseenter", function() {
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.zoom, "mouseleave", function() {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
}
} else {
self.bind((cap.hasmousecapture) ? self.win : document, "mouseup", self.ontouchend);
self.bind(document, "mousemove", self.ontouchmove);
if (self.onclick) self.bind(document, "click", self.onclick);
if (self.opt.cursordragontouch) {
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mousemove", self.onmousemove);
self.cursorh && self.bind(self.cursorh, "mousedown", function(e) {
self.onmousedown(e, true)
});
self.cursorh && self.bind(self.cursorh, "mousemove", self.onmousemove);
}
}
if (self.opt.enablemousewheel) {
if (!self.isiframe) self.bind((cap.isie && self.ispage) ? document : self.win /*self.docscroll*/ , "mousewheel", self.onmousewheel);
self.bind(self.rail, "mousewheel", self.onmousewheel);
if (self.railh) self.bind(self.railh, "mousewheel", self.onmousewheelhr);
}
if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
if (!self.win.attr("tabindex")) self.win.attr({
"tabindex": tabindexcounter++
});
self.jqbind(self.win, "focus", function(e) {
domfocus = (self.getTarget(e)).id || true;
self.hasfocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.jqbind(self.win, "blur", function(e) {
domfocus = false;
self.hasfocus = false;
});
self.jqbind(self.win, "mouseenter", function(e) {
mousefocus = (self.getTarget(e)).id || true;
self.hasmousefocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.jqbind(self.win, "mouseleave", function() {
mousefocus = false;
self.hasmousefocus = false;
if (!self.rail.drag) self.hideCursor();
});
};
} // !ie9mobile
//Thanks to http://www.quirksmode.org !!
self.onkeypress = function(e) {
if (self.locked && self.page.maxh == 0) return true;
e = (e) ? e : window.e;
var tg = self.getTarget(e);
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
var tp = tg.getAttribute('type') || tg.type || false;
if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
}
if ($(tg).attr('contenteditable')) return true;
if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
var key = e.keyCode;
if (self.locked && key != 27) return self.cancelEvent(e);
var ctrl = e.ctrlKey || false;
var shift = e.shiftKey || false;
var ret = false;
switch (key) {
case 38:
case 63233: //safari
self.doScrollBy(24 * 3);
ret = true;
break;
case 40:
case 63235: //safari
self.doScrollBy(-24 * 3);
ret = true;
break;
case 37:
case 63232: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3);
ret = true;
}
break;
case 39:
case 63234: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3);
ret = true;
}
break;
case 33:
case 63276: // safari
self.doScrollBy(self.view.h);
ret = true;
break;
case 34:
case 63277: // safari
self.doScrollBy(-self.view.h);
ret = true;
break;
case 36:
case 63273: // safari
(self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0);
ret = true;
break;
case 35:
case 63275: // safari
(self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh);
ret = true;
break;
case 32:
if (self.opt.spacebarenabled) {
(shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
ret = true;
}
break;
case 27: // ESC
if (self.zoomactive) {
self.doZoom();
ret = true;
}
break;
}
if (ret) return self.cancelEvent(e);
}
};
if (self.opt.enablekeyboard) self.bind(document, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
self.bind(document, "keydown", function(e) {
var ctrl = e.ctrlKey || false;
if (ctrl) self.wheelprevented = true;
});
self.bind(document, "keyup", function(e) {
var ctrl = e.ctrlKey || false;
if (!ctrl) self.wheelprevented = false;
});
self.bind(window, 'resize', self.lazyResize);
self.bind(window, 'orientationchange', self.lazyResize);
self.bind(window, "load", self.lazyResize);
if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
var tmp = self.win.attr("style");
var ww = parseFloat(self.win.css("width")) + 1;
self.win.css('width', ww);
self.synched("chromefix", function() {
self.win.attr("style", tmp)
});
}
// Trying a cross-browser implementation - good luck!
self.onAttributeChange = function(e) {
self.lazyResize(250);
};
if (!self.ispage && !self.haswrapper) {
// redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
if (clsMutationObserver !== false) {
self.observer = new clsMutationObserver(function(mutations) {
mutations.forEach(self.onAttributeChange);
});
self.observer.observe(self.win[0], {
childList: true,
characterData: false,
attributes: true,
subtree: false
});
self.observerremover = new clsMutationObserver(function(mutations) {
mutations.forEach(function(mo) {
if (mo.removedNodes.length > 0) {
for (var dd in mo.removedNodes) {
if (mo.removedNodes[dd] == self.win[0]) return self.remove();
}
}
});
});
self.observerremover.observe(self.win[0].parentNode, {
childList: true,
characterData: false,
attributes: false,
subtree: false
});
} else {
self.bind(self.win, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
if (cap.isie9) self.win[0].attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
self.bind(self.win, "DOMNodeRemoved", function(e) {
if (e.target == self.win[0]) self.remove();
});
}
}
//
if (!self.ispage && self.opt.boxzoom) self.bind(window, "resize", self.resizeZoom);
if (self.istextarea) self.bind(self.win, "mouseup", self.lazyResize);
// self.checkrtlmode = true;
self.lazyResize(30);
}
if (this.doc[0].nodeName == 'IFRAME') {
function oniframeload(e) {
self.iframexd = false;
try {
var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document;
var a = doc.domain;
} catch (e) {
self.iframexd = true;
doc = false
};
if (self.iframexd) {
if ("console" in window) console.log('NiceScroll error: policy restriced iframe');
return true; //cross-domain - I can't manage this
}
self.forcescreen = true;
if (self.isiframe) {
self.iframe = {
"doc": $(doc),
"html": self.doc.contents().find('html')[0],
"body": self.doc.contents().find('body')[0]
};
self.getContentSize = function() {
return {
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
};
};
self.docscroll = $(self.iframe.body); //$(this.contentWindow);
}
if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0); // reset position
self.doc.height(""); //reset height to fix browser bug
var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
self.doc.height(hh);
}
self.lazyResize(30);
if (cap.isie7) self.css($(self.iframe.html), {
'overflow-y': 'hidden'
});
//self.css($(doc.body),{'overflow-y':'hidden'});
self.css($(self.iframe.body), {
'overflow-y': 'hidden'
});
if (cap.isios && self.haswrapper) {
self.css($(doc.body), {
'-webkit-transform': 'translate3d(0,0,0)'
}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
}
if ('contentWindow' in this) {
self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
} else {
self.bind(doc, "scroll", self.onscroll);
}
if (self.opt.enablemousewheel) {
self.bind(doc, "mousewheel", self.onmousewheel);
}
if (self.opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
if (cap.cantouch || self.opt.touchbehavior) {
self.bind(doc, "mousedown", self.ontouchstart);
self.bind(doc, "mousemove", function(e) {
self.ontouchmove(e, true)
});
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
'cursor': cap.cursorgrabvalue
});
}
self.bind(doc, "mouseup", self.ontouchend);
if (self.zoom) {
if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
}
};
if (this.doc[0].readyState && this.doc[0].readyState == "complete") {
setTimeout(function() {
oniframeload.call(self.doc[0], false)
}, 500);
}
self.bind(this.doc, "load", oniframeload);
}
};
this.showCursor = function(py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout);
self.cursortimeout = 0;
}
if (!self.rail) return;
if (self.autohidedom) {
self.autohidedom.stop().css({
opacity: self.opt.cursoropacitymax
});
self.cursoractive = true;
}
if (!self.rail.drag || self.rail.drag.pt != 1) {
if ((typeof py != "undefined") && (py !== false)) {
self.scroll.y = Math.round(py * 1 / self.scrollratio.y);
}
if (typeof px != "undefined") {
self.scroll.x = Math.round(px * 1 / self.scrollratio.x); //-cxscrollleft * Math.round(px * 1/self.scrollratio.x);
}
}
self.cursor.css({
height: self.cursorheight,
top: self.scroll.y
});
if (self.cursorh) {
(!self.rail.align && self.rail.visibility) ? self.cursorh.css({
width: self.cursorwidth,
left: self.scroll.x + self.rail.width
}) : self.cursorh.css({
width: self.cursorwidth,
left: self.scroll.x
});
self.cursoractive = true;
}
if (self.zoom) self.zoom.stop().css({
opacity: self.opt.cursoropacitymax
});
};
this.hideCursor = function(tm) {
if (self.cursortimeout) return;
if (!self.rail) return;
if (!self.autohidedom) return;
if (self.hasmousefocus && self.opt.autohidemode == "leave") return;
self.cursortimeout = setTimeout(function() {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({
opacity: self.opt.cursoropacitymin
});
if (self.zoom) self.zoom.stop().animate({
opacity: self.opt.cursoropacitymin
});
self.cursoractive = false;
}
self.cursortimeout = 0;
}, tm || self.opt.hidecursordelay);
};
this.noticeCursor = function(tm, py, px) {
self.showCursor(py, px);
if (!self.rail.active) self.hideCursor(tm);
};
this.getContentSize =
(self.ispage) ?
function() {
return {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
}
} : (self.haswrapper) ?
function() {
return {
w: self.doc.outerWidth() + parseInt(self.win.css('paddingLeft')) + parseInt(self.win.css('paddingRight')),
h: self.doc.outerHeight() + parseInt(self.win.css('paddingTop')) + parseInt(self.win.css('paddingBottom'))
}
} : function() {
return {
w: self.docscroll[0].scrollWidth,
h: self.docscroll[0].scrollHeight
}
};
this.onResize = function(e, page) {
if (!self || !self.win) return false;
if (!self.haswrapper && !self.ispage) {
if (self.win.css('display') == 'none') {
if (self.visibility) self.hideRail().hideRailHr();
return false;
} else {
if (!self.hidden && !self.visibility) self.showRail().showRailHr();
}
}
var premaxh = self.page.maxh;
var premaxw = self.page.maxw;
var preview = {
h: self.view.h,
w: self.view.w
};
self.view = {
w: (self.ispage) ? self.win.width() : parseInt(self.win[0].clientWidth),
h: (self.ispage) ? self.win.height() : parseInt(self.win[0].clientHeight)
};
self.page = (page) ? page : self.getContentSize();
self.page.maxh = Math.max(0, self.page.h - self.view.h);
self.page.maxw = Math.max(0, self.page.w - self.view.w);
if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == preview.w)) {
// test position
if (!self.ispage) {
var pos = self.win.offset();
if (self.lastposition) {
var lst = self.lastposition;
if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
}
self.lastposition = pos;
} else {
return self; //nothing to do
}
}
if (self.page.maxh == 0) {
self.hideRail();
self.scrollvaluemax = 0;
self.scroll.y = 0;
self.scrollratio.y = 0;
self.cursorheight = 0;
self.setScrollTop(0);
self.rail.scrollable = false;
} else {
self.rail.scrollable = true;
}
if (self.page.maxw == 0) {
self.hideRailHr();
self.scrollvaluemaxw = 0;
self.scroll.x = 0;
self.scrollratio.x = 0;
self.cursorwidth = 0;
self.setScrollLeft(0);
self.railh.scrollable = false;
} else {
self.railh.scrollable = true;
}
self.locked = (self.page.maxh == 0) && (self.page.maxw == 0);
if (self.locked) {
if (!self.ispage) self.updateScrollBar(self.view);
return false;
}
if (!self.hidden && !self.visibility) {
self.showRail().showRailHr();
} else if (!self.hidden && !self.railh.visibility) self.showRailHr();
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
self.cursorheight = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorheight);
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
self.cursorwidth = (self.opt.cursorfixedheight) ? self.opt.cursorfixedheight : Math.max(self.opt.cursorminheight, self.cursorwidth);
self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder;
if (self.railh) {
self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder;
}
/*
if (self.checkrtlmode&&self.railh) {
self.checkrtlmode = false;
if (self.opt.rtlmode&&self.scroll.x==0) self.setScrollLeft(self.page.maxw);
}
*/
if (!self.ispage) self.updateScrollBar(self.view);
self.scrollratio = {
x: (self.page.maxw / self.scrollvaluemaxw),
y: (self.page.maxh / self.scrollvaluemax)
};
var sy = self.getScrollTop();
if (sy > self.page.maxh) {
self.doScrollTop(self.page.maxh);
} else {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
if (self.cursoractive) self.noticeCursor();
}
if (self.scroll.y && (self.getScrollTop() == 0)) self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y));
return self;
};
this.resize = self.onResize;
this.lazyResize = function(tm) { // event debounce
tm = (isNaN(tm)) ? 30 : tm;
self.delayed('resize', self.resize, tm);
return self;
};
// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
function _modernWheelEvent(dom, name, fn, bubble) {
self._bind(dom, name, function(e) {
var e = (e) ? e : window.event;
var event = {
original: e,
target: e.target || e.srcElement,
type: "wheel",
deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
deltaX: 0,
deltaZ: 0,
preventDefault: function() {
e.preventDefault ? e.preventDefault() : e.returnValue = false;
return false;
},
stopImmediatePropagation: function() {
(e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;
}
};
if (name == "mousewheel") {
event.deltaY = -1 / 40 * e.wheelDelta;
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
} else {
event.deltaY = e.detail;
}
return fn.call(dom, event);
}, bubble);
};
this._bind = function(el, name, fn, bubble) { // primitive bind
self.events.push({
e: el,
n: name,
f: fn,
b: bubble,
q: false
});
if (el.addEventListener) {
el.addEventListener(name, fn, bubble || false);
} else if (el.attachEvent) {
el.attachEvent("on" + name, fn);
} else {
el["on" + name] = fn;
}
};
this.jqbind = function(dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
self.events.push({
e: dom,
n: name,
f: fn,
q: true
});
$(dom).bind(name, fn);
};
this.bind = function(dom, name, fn, bubble) { // touch-oriented & fixing jquery bind
var el = ("jquery" in dom) ? dom[0] : dom;
if (name == 'mousewheel') {
if ("onwheel" in self.win) {
self._bind(el, "wheel", fn, bubble || false);
} else {
var wname = (typeof document.onmousewheel != "undefined") ? "mousewheel" : "DOMMouseScroll"; // older IE/Firefox
_modernWheelEvent(el, wname, fn, bubble || false);
if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
}
} else if (el.addEventListener) {
if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { // touch device support
var tt = (name == 'mousedown') ? 'touchstart' : (name == 'mouseup') ? 'touchend' : 'touchmove';
self._bind(el, tt, function(e) {
if (e.touches) {
if (e.touches.length < 2) {
var ev = (e.touches.length) ? e.touches[0] : e;
ev.original = e;
fn.call(this, ev);
}
} else if (e.changedTouches) {
var ev = e.changedTouches[0];
ev.original = e;
fn.call(this, ev);
} //blackberry
}, bubble || false);
}
self._bind(el, name, fn, bubble || false);
if (cap.cantouch && name == "mouseup") self._bind(el, "touchcancel", fn, bubble || false);
} else {
self._bind(el, name, function(e) {
e = e || window.event || false;
if (e) {
if (e.srcElement) e.target = e.srcElement;
}
if (!("pageY" in e)) {
e.pageX = e.clientX + document.documentElement.scrollLeft;
e.pageY = e.clientY + document.documentElement.scrollTop;
}
return ((fn.call(el, e) === false) || bubble === false) ? self.cancelEvent(e) : true;
});
}
};
this._unbind = function(el, name, fn, bub) { // primitive unbind
if (el.removeEventListener) {
el.removeEventListener(name, fn, bub);
} else if (el.detachEvent) {
el.detachEvent('on' + name, fn);
} else {
el['on' + name] = false;
}
};
this.unbindAll = function() {
for (var a = 0; a < self.events.length; a++) {
var r = self.events[a];
(r.q) ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b);
}
};
// Thanks to http://www.switchonthecode.com !!
this.cancelEvent = function(e) {
var e = (e.original) ? e.original : (e) ? e : window.event || false;
if (!e) return false;
if (e.preventDefault) e.preventDefault();
if (e.stopPropagation) e.stopPropagation();
if (e.preventManipulation) e.preventManipulation(); //IE10
e.cancelBubble = true;
e.cancel = true;
e.returnValue = false;
return false;
};
this.stopPropagation = function(e) {
var e = (e.original) ? e.original : (e) ? e : window.event || false;
if (!e) return false;
if (e.stopPropagation) return e.stopPropagation();
if (e.cancelBubble) e.cancelBubble = true;
return false;
};
this.showRail = function() {
if ((self.page.maxh != 0) && (self.ispage || self.win.css('display') != 'none')) {
self.visibility = true;
self.rail.visibility = true;
self.rail.css('display', 'block');
}
return self;
};
this.showRailHr = function() {
if (!self.railh) return self;
if ((self.page.maxw != 0) && (self.ispage || self.win.css('display') != 'none')) {
self.railh.visibility = true;
self.railh.css('display', 'block');
}
return self;
};
this.hideRail = function() {
self.visibility = false;
self.rail.visibility = false;
self.rail.css('display', 'none');
return self;
};
this.hideRailHr = function() {
if (!self.railh) return self;
self.railh.visibility = false;
self.railh.css('display', 'none');
return self;
};
this.show = function() {
self.hidden = false;
self.locked = false;
return self.showRail().showRailHr();
};
this.hide = function() {
self.hidden = true;
self.locked = true;
return self.hideRail().hideRailHr();
};
this.toggle = function() {
return (self.hidden) ? self.show() : self.hide();
};
this.remove = function() {
self.stop();
if (self.cursortimeout) clearTimeout(self.cursortimeout);
self.doZoomOut();
self.unbindAll();
if (cap.isie9) self.win[0].detachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
if (self.observer !== false) self.observer.disconnect();
if (self.observerremover !== false) self.observerremover.disconnect();
self.events = null;
if (self.cursor) {
self.cursor.remove();
}
if (self.cursorh) {
self.cursorh.remove();
}
if (self.rail) {
self.rail.remove();
}
if (self.railh) {
self.railh.remove();
}
if (self.zoom) {
self.zoom.remove();
}
for (var a = 0; a < self.saved.css.length; a++) {
var d = self.saved.css[a];
d[0].css(d[1], (typeof d[2] == "undefined") ? '' : d[2]);
}
self.saved = false;
self.me.data('__nicescroll', ''); //erase all traces
// memory leak fixed by GianlucaGuarini - thanks a lot!
// remove the current nicescroll from the $.nicescroll array & normalize array
var lst = $.nicescroll;
lst.each(function(i) {
if (!this) return;
if (this.id === self.id) {
delete lst[i];
for (var b = ++i; b < lst.length; b++, i++) lst[i] = lst[b];
lst.length--;
if (lst.length) delete lst[lst.length];
}
});
for (var i in self) {
self[i] = null;
delete self[i];
}
self = null;
};
this.scrollstart = function(fn) {
this.onscrollstart = fn;
return self;
};
this.scrollend = function(fn) {
this.onscrollend = fn;
return self;
};
this.scrollcancel = function(fn) {
this.onscrollcancel = fn;
return self;
};
this.zoomin = function(fn) {
this.onzoomin = fn;
return self;
};
this.zoomout = function(fn) {
this.onzoomout = fn;
return self;
};
this.isScrollable = function(e) {
var dom = (e.target) ? e.target : e;
if (dom.nodeName == 'OPTION') return true;
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
if (/scroll|auto/.test(ov)) return (dom.clientHeight != dom.scrollHeight);
dom = (dom.parentNode) ? dom.parentNode : false;
}
return false;
};
this.getViewport = function(me) {
var dom = (me && me.parentNode) ? me.parentNode : false;
while (dom && (dom.nodeType == 1) && !(/^BODY|HTML/.test(dom.nodeName))) {
var dd = $(dom);
if (/fixed|absolute/.test(dd.css("position"))) return dd;
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '';
if ((/scroll|auto/.test(ov)) && (dom.clientHeight != dom.scrollHeight)) return dd;
if (dd.getNiceScroll().length > 0) return dd;
dom = (dom.parentNode) ? dom.parentNode : false;
}
return (dom) ? $(dom) : false;
};
this.triggerScrollEnd = function() {
if (!self.onscrollend) return;
var px = self.getScrollLeft();
var py = self.getScrollTop();
var info = {
"type": "scrollend",
"current": {
"x": px,
"y": py
},
"end": {
"x": px,
"y": py
}
};
self.onscrollend.call(self, info);
}
function execScrollWheel(e, hr, chkscroll) {
var px, py;
var rt = 1;
if (e.deltaMode == 0) { // PIXEL
px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)));
py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)));
} else if (e.deltaMode == 1) { // LINE
px = -Math.floor(e.deltaX * self.opt.mousescrollstep);
py = -Math.floor(e.deltaY * self.opt.mousescrollstep);
}
if (hr && self.opt.oneaxismousemode && (px == 0) && py) { // classic vertical-only mousewheel + browser with x/y support
px = py;
py = 0;
}
if (px) {
if (self.scrollmom) {
self.scrollmom.stop()
}
self.lastdeltax += px;
self.debounced("mousewheelx", function() {
var dt = self.lastdeltax;
self.lastdeltax = 0;
if (!self.rail.drag) {
self.doScrollLeftBy(dt)
}
}, 15);
}
if (py) {
if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
if (py < 0) {
if (self.getScrollTop() >= self.page.maxh) return true;
} else {
if (self.getScrollTop() <= 0) return true;
}
}
if (self.scrollmom) {
self.scrollmom.stop()
}
self.lastdeltay += py;
self.debounced("mousewheely", function() {
var dt = self.lastdeltay;
self.lastdeltay = 0;
if (!self.rail.drag) {
self.doScrollBy(dt)
}
}, 15);
}
e.stopImmediatePropagation();
return e.preventDefault();
// return self.cancelEvent(e);
};
this.onmousewheel = function(e) {
if (self.wheelprevented) return;
if (self.locked) {
self.debounced("checkunlock", self.resize, 250);
return true;
}
if (self.rail.drag) return self.cancelEvent(e);
if (self.opt.oneaxismousemode == "auto" && e.deltaX != 0) self.opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
if (self.opt.oneaxismousemode && e.deltaX == 0) {
if (!self.rail.scrollable) {
if (self.railh && self.railh.scrollable) {
return self.onmousewheelhr(e);
} else {
return true;
}
}
}
var nw = +(new Date());
var chk = false;
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
// self.checkarea = false;
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this isn't my business
// if (self.locked) return self.cancelEvent(e);
var ret = execScrollWheel(e, false, chk);
if (ret) self.checkarea = 0;
return ret;
};
this.onmousewheelhr = function(e) {
if (self.wheelprevented) return;
if (self.locked || !self.railh.scrollable) return true;
if (self.rail.drag) return self.cancelEvent(e);
var nw = +(new Date());
var chk = false;
if (self.opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
// self.checkarea = false;
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this isn't my business
if (self.locked) return self.cancelEvent(e);
return execScrollWheel(e, true, chk);
};
this.stop = function() {
self.cancelScroll();
if (self.scrollmon) self.scrollmon.stop();
self.cursorfreezed = false;
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.noticeCursor();
return self;
};
this.getTransitionSpeed = function(dif) {
var sp = Math.round(self.opt.scrollspeed * 10);
var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed));
return (ex > 20) ? ex : 0;
};
if (!self.opt.smoothscroll) {
this.doScrollLeft = function(x, spd) { //direct
var y = self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function(y, spd) { //direct
var x = self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function(x, y, spd) { //direct
var nx = (x > self.page.maxw) ? self.page.maxw : x;
if (nx < 0) nx = 0;
var ny = (y > self.page.maxh) ? self.page.maxh : y;
if (ny < 0) ny = 0;
self.synched('scroll', function() {
self.setScrollTop(ny);
self.setScrollLeft(nx);
});
};
this.cancelScroll = function() {}; // direct
} else if (self.ishwscroll && cap.hastransition && self.opt.usetransition) {
this.prepareTransition = function(dif, istime) {
var ex = (istime) ? ((dif > 20) ? dif : 0) : self.getTransitionSpeed(dif);
var trans = (ex) ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '';
if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
self.lasttransitionstyle = trans;
self.doc.css(cap.transitionstyle, trans);
}
return ex;
};
this.doScrollLeft = function(x, spd) { //trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function(y, spd) { //trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function(x, y, spd) { //trans
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
if (self.opt.bouncescroll == false) {
if (y < 0) y = 0;
else if (y > self.page.maxh) y = self.page.maxh;
if (x < 0) x = 0;
else if (x > self.page.maxw) x = self.page.maxw;
}
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
self.newscrolly = y;
self.newscrollx = x;
self.newscrollspeed = spd || false;
if (self.timer) return false;
self.timer = setTimeout(function() {
var top = self.getScrollTop();
var lft = self.getScrollLeft();
var dst = {};
dst.x = x - lft;
dst.y = y - top;
dst.px = lft;
dst.py = top;
var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)));
// var df = (self.newscrollspeed) ? self.newscrollspeed : dd;
var ms = (self.newscrollspeed && self.newscrollspeed > 1) ? self.newscrollspeed : self.getTransitionSpeed(dd);
if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed;
self.prepareTransition(ms, true);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
if (ms > 0) {
if (!self.scrollrunning && self.onscrollstart) {
var info = {
"type": "scrollstart",
"current": {
"x": lft,
"y": top
},
"request": {
"x": x,
"y": y
},
"end": {
"x": self.newscrollx,
"y": self.newscrolly
},
"speed": ms
};
self.onscrollstart.call(self, info);
}
if (cap.transitionend) {
if (!self.scrollendtrapped) {
self.scrollendtrapped = true;
self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
}
} else {
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
}
var py = top;
var px = lft;
self.timerscroll = {
bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
};
if (!self.cursorfreezed) self.timerscroll.tm = setInterval(function() {
self.showCursor(self.getScrollTop(), self.getScrollLeft())
}, 60);
}
self.synched("doScroll-set", function() {
self.timer = 0;
if (self.scrollendtrapped) self.scrollrunning = true;
self.setScrollTop(self.newscrolly);
self.setScrollLeft(self.newscrollx);
if (!self.scrollendtrapped) self.onScrollTransitionEnd();
});
}, 50);
};
this.cancelScroll = function() {
if (!self.scrollendtrapped) return true;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.scrollrunning = false;
if (!cap.transitionend) clearTimeout(cap.transitionend);
self.scrollendtrapped = false;
self._unbind(self.doc, cap.transitionend, self.onScrollTransitionEnd);
self.prepareTransition(0);
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
self.cursorfreezed = false;
//self.noticeCursor(false,py,px);
self.showCursor(py, px);
return self;
};
this.onScrollTransitionEnd = function() {
if (self.scrollendtrapped) self._unbind(self.doc, cap.transitionend, self.onScrollTransitionEnd);
self.scrollendtrapped = false;
self.prepareTransition(0);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px); // fire event onscroll left
self.noticeCursor(false, py, px);
self.cursorfreezed = false;
if (py < 0) py = 0
else if (py > self.page.maxh) py = self.page.maxh;
if (px < 0) px = 0
else if (px > self.page.maxw) px = self.page.maxw;
if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, self.opt.snapbackspeed);
if (self.onscrollend && self.scrollrunning) {
// var info = {"type":"scrollend","current":{"x":px,"y":py},"end":{"x":self.newscrollx,"y":self.newscrolly}};
// self.onscrollend.call(self,info);
self.triggerScrollEnd();
}
self.scrollrunning = false;
};
} else {
this.doScrollLeft = function(x, spd) { //no-trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function(y, spd) { //no-trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function(x, y, spd) { //no-trans
var y = ((typeof y == "undefined") || (y === false)) ? self.getScrollTop(true) : y;
if ((self.timer) && (self.newscrolly == y) && (self.newscrollx == x)) return true;
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
self.newscrolly = y;
self.newscrollx = x;
if (!self.bouncescroll || !self.rail.visibility) {
if (self.newscrolly < 0) {
self.newscrolly = 0;
} else if (self.newscrolly > self.page.maxh) {
self.newscrolly = self.page.maxh;
}
}
if (!self.bouncescroll || !self.railh.visibility) {
if (self.newscrollx < 0) {
self.newscrollx = 0;
} else if (self.newscrollx > self.page.maxw) {
self.newscrollx = self.page.maxw;
}
}
self.dst = {};
self.dst.x = x - px;
self.dst.y = y - py;
self.dst.px = px;
self.dst.py = py;
var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)));
self.dst.ax = self.dst.x / dst;
self.dst.ay = self.dst.y / dst;
var pa = 0;
var pe = dst;
if (self.dst.x == 0) {
pa = py;
pe = y;
self.dst.ay = 1;
self.dst.py = 0;
} else if (self.dst.y == 0) {
pa = px;
pe = x;
self.dst.ax = 1;
self.dst.px = 0;
}
var ms = self.getTransitionSpeed(dst);
if (spd && spd <= 1) ms *= spd;
if (ms > 0) {
self.bzscroll = (self.bzscroll) ? self.bzscroll.update(pe, ms) : new BezierClass(pa, pe, ms, 0, 1, 0, 1);
} else {
self.bzscroll = false;
}
if (self.timer) return;
if ((py == self.page.maxh && y >= self.page.maxh) || (px == self.page.maxw && x >= self.page.maxw)) self.checkContentSize();
var sync = 1;
function scrolling() {
if (self.cancelAnimationFrame) return true;
self.scrollrunning = true;
sync = 1 - sync;
if (sync) return (self.timer = setAnimationFrame(scrolling) || 1);
var done = 0;
var sc = sy = self.getScrollTop();
if (self.dst.ay) {
sc = (self.bzscroll) ? self.dst.py + (self.bzscroll.getNow() * self.dst.ay) : self.newscrolly;
var dr = sc - sy;
if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) sc = self.newscrolly;
self.setScrollTop(sc);
if (sc == self.newscrolly) done = 1;
} else {
done = 1;
}
var scx = sx = self.getScrollLeft();
if (self.dst.ax) {
scx = (self.bzscroll) ? self.dst.px + (self.bzscroll.getNow() * self.dst.ax) : self.newscrollx;
var dr = scx - sx;
if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) scx = self.newscrollx;
self.setScrollLeft(scx);
if (scx == self.newscrollx) done += 1;
} else {
done += 1;
}
if (done == 2) {
self.timer = 0;
self.cursorfreezed = false;
self.bzscroll = false;
self.scrollrunning = false;
if (sc < 0) sc = 0;
else if (sc > self.page.maxh) sc = self.page.maxh;
if (scx < 0) scx = 0;
else if (scx > self.page.maxw) scx = self.page.maxw;
if ((scx != self.newscrollx) || (sc != self.newscrolly)) self.doScrollPos(scx, sc);
else {
if (self.onscrollend) {
/*
var info = {"type":"scrollend","current":{"x":sx,"y":sy},"end":{"x":self.newscrollx,"y":self.newscrolly}};
self.onscrollend.call(self,info);
*/
self.triggerScrollEnd();
}
}
} else {
self.timer = setAnimationFrame(scrolling) || 1;
}
};
self.cancelAnimationFrame = false;
self.timer = 1;
if (self.onscrollstart && !self.scrollrunning) {
var info = {
"type": "scrollstart",
"current": {
"x": px,
"y": py
},
"request": {
"x": x,
"y": y
},
"end": {
"x": self.newscrollx,
"y": self.newscrolly
},
"speed": ms
};
self.onscrollstart.call(self, info);
}
scrolling();
if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) self.checkContentSize();
self.noticeCursor();
};
this.cancelScroll = function() {
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
self.bzscroll = false;
self.scrollrunning = false;
return self;
};
}
this.doScrollBy = function(stp, relative) {
var ny = 0;
if (relative) {
ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
} else {
var sy = (self.timer) ? self.newscrolly : self.getScrollTop(true);
ny = sy - stp;
}
if (self.bouncescroll) {
var haf = Math.round(self.view.h / 2);
if (ny < -haf) ny = -haf
else if (ny > (self.page.maxh + haf)) ny = (self.page.maxh + haf);
}
self.cursorfreezed = false;
py = self.getScrollTop(true);
if (ny < 0 && py <= 0) return self.noticeCursor();
else if (ny > self.page.maxh && py >= self.page.maxh) {
self.checkContentSize();
return self.noticeCursor();
}
self.doScrollTop(ny);
};
this.doScrollLeftBy = function(stp, relative) {
var nx = 0;
if (relative) {
nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
} else {
var sx = (self.timer) ? self.newscrollx : self.getScrollLeft(true);
nx = sx - stp;
}
if (self.bouncescroll) {
var haf = Math.round(self.view.w / 2);
if (nx < -haf) nx = -haf;
else if (nx > (self.page.maxw + haf)) nx = (self.page.maxw + haf);
}
self.cursorfreezed = false;
px = self.getScrollLeft(true);
if (nx < 0 && px <= 0) return self.noticeCursor();
else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor();
self.doScrollLeft(nx);
};
this.doScrollTo = function(pos, relative) {
var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
if (ny < 0) ny = 0;
else if (ny > self.page.maxh) ny = self.page.maxh;
self.cursorfreezed = false;
self.doScrollTop(pos);
};
this.checkContentSize = function() {
var pg = self.getContentSize();
if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
};
self.onscroll = function(e) {
if (self.rail.drag) return;
if (!self.cursorfreezed) {
self.synched('scroll', function() {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x));
self.noticeCursor();
});
}
};
self.bind(self.docscroll, "scroll", self.onscroll);
this.doZoomIn = function(e) {
if (self.zoomactive) return;
self.zoomactive = true;
self.zoomrestore = {
style: {}
};
var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
var win = self.win[0].style;
for (var a in lst) {
var pp = lst[a];
self.zoomrestore.style[pp] = (typeof win[pp] != "undefined") ? win[pp] : '';
}
self.zoomrestore.style.width = self.win.css('width');
self.zoomrestore.style.height = self.win.css('height');
self.zoomrestore.padding = {
w: self.win.outerWidth() - self.win.width(),
h: self.win.outerHeight() - self.win.height()
};
if (cap.isios4) {
self.zoomrestore.scrollTop = $(window).scrollTop();
$(window).scrollTop(0);
}
self.win.css({
"position": (cap.isios4) ? "absolute" : "fixed",
"top": 0,
"left": 0,
"z-index": globalmaxzindex + 100,
"margin": "0px"
});
var bkg = self.win.css("backgroundColor");
if (bkg == "" || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
self.rail.css({
"z-index": globalmaxzindex + 101
});
self.zoom.css({
"z-index": globalmaxzindex + 102
});
self.zoom.css('backgroundPosition', '0px -18px');
self.resizeZoom();
if (self.onzoomin) self.onzoomin.call(self);
return self.cancelEvent(e);
};
this.doZoomOut = function(e) {
if (!self.zoomactive) return;
self.zoomactive = false;
self.win.css("margin", "");
self.win.css(self.zoomrestore.style);
if (cap.isios4) {
$(window).scrollTop(self.zoomrestore.scrollTop);
}
self.rail.css({
"z-index": self.zindex
});
self.zoom.css({
"z-index": self.zindex
});
self.zoomrestore = false;
self.zoom.css('backgroundPosition', '0px 0px');
self.onResize();
if (self.onzoomout) self.onzoomout.call(self);
return self.cancelEvent(e);
};
this.doZoom = function(e) {
return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
};
this.resizeZoom = function() {
if (!self.zoomactive) return;
var py = self.getScrollTop(); //preserve scrolling position
self.win.css({
width: $(window).width() - self.zoomrestore.padding.w + "px",
height: $(window).height() - self.zoomrestore.padding.h + "px"
});
self.onResize();
self.setScrollTop(Math.min(self.page.maxh, py));
};
this.init();
$.nicescroll.push(this);
};
// Inspired by the work of Kin Blas
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
var ScrollMomentumClass2D = function(nc) {
var self = this;
this.nc = nc;
this.lastx = 0;
this.lasty = 0;
this.speedx = 0;
this.speedy = 0;
this.lasttime = 0;
this.steptime = 0;
this.snapx = false;
this.snapy = false;
this.demulx = 0;
this.demuly = 0;
this.lastscrollx = -1;
this.lastscrolly = -1;
this.chkx = 0;
this.chky = 0;
this.timer = 0;
this.time = function() {
return +new Date(); //beautifull hack
};
this.reset = function(px, py) {
self.stop();
var now = self.time();
self.steptime = 0;
self.lasttime = now;
self.speedx = 0;
self.speedy = 0;
self.lastx = px;
self.lasty = py;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
this.update = function(px, py) {
var now = self.time();
self.steptime = now - self.lasttime;
self.lasttime = now;
var dy = py - self.lasty;
var dx = px - self.lastx;
var sy = self.nc.getScrollTop();
var sx = self.nc.getScrollLeft();
var newy = sy + dy;
var newx = sx + dx;
self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
self.speedx = dx;
self.speedy = dy;
self.lastx = px;
self.lasty = py;
};
this.stop = function() {
self.nc.unsynched("domomentum2d");
if (self.timer) clearTimeout(self.timer);
self.timer = 0;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
this.doSnapy = function(nx, ny) {
var snap = false;
if (ny < 0) {
ny = 0;
snap = true;
} else if (ny > self.nc.page.maxh) {
ny = self.nc.page.maxh;
snap = true;
}
if (nx < 0) {
nx = 0;
snap = true;
} else if (nx > self.nc.page.maxw) {
nx = self.nc.page.maxw;
snap = true;
}
(snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd();
};
this.doMomentum = function(gp) {
var t = self.time();
var l = (gp) ? t + gp : self.lasttime;
var sl = self.nc.getScrollLeft();
var st = self.nc.getScrollTop();
var pageh = self.nc.page.maxh;
var pagew = self.nc.page.maxw;
self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
var chk = l && (t - l) <= 60;
if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
var sy = (self.speedy && chk) ? self.speedy : false;
var sx = (self.speedx && chk) ? self.speedx : false;
if (sy || sx) {
var tm = Math.max(16, self.steptime); //timeout granularity
if (tm > 50) { // do smooth
var xm = tm / 50;
self.speedx *= xm;
self.speedy *= xm;
tm = 50;
}
self.demulxy = 0;
self.lastscrollx = self.nc.getScrollLeft();
self.chkx = self.lastscrollx;
self.lastscrolly = self.nc.getScrollTop();
self.chky = self.lastscrolly;
var nx = self.lastscrollx;
var ny = self.lastscrolly;
var onscroll = function() {
var df = ((self.time() - t) > 600) ? 0.04 : 0.02;
if (self.speedx) {
nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
self.lastscrollx = nx;
if ((nx < 0) || (nx > pagew)) df = 0.10;
}
if (self.speedy) {
ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
self.lastscrolly = ny;
if ((ny < 0) || (ny > pageh)) df = 0.10;
}
self.demulxy = Math.min(1, self.demulxy + df);
self.nc.synched("domomentum2d", function() {
if (self.speedx) {
var scx = self.nc.getScrollLeft();
if (scx != self.chkx) self.stop();
self.chkx = nx;
self.nc.setScrollLeft(nx);
}
if (self.speedy) {
var scy = self.nc.getScrollTop();
if (scy != self.chky) self.stop();
self.chky = ny;
self.nc.setScrollTop(ny);
}
if (!self.timer) {
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
});
if (self.demulxy < 1) {
self.timer = setTimeout(onscroll, tm);
} else {
self.stop();
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
};
onscroll();
} else {
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
}
}
};
// override jQuery scrollTop
var _scrollTop = jQuery.fn.scrollTop; // preserve original function
jQuery.cssHooks["pageYOffset"] = {
get: function(elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
},
set: function(elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value);
return this;
}
};
/*
$.fx.step["scrollTop"] = function(fx){
$.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
};
*/
jQuery.fn.scrollTop = function(value) {
if (typeof value == "undefined") {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
} else {
return this.each(function() {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value);
});
}
};
// override jQuery scrollLeft
var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
$.cssHooks.pageXOffset = {
get: function(elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
},
set: function(elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value);
return this;
}
};
/*
$.fx.step["scrollLeft"] = function(fx){
$.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
};
*/
jQuery.fn.scrollLeft = function(value) {
if (typeof value == "undefined") {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
} else {
return this.each(function() {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value);
});
}
};
var NiceScrollArray = function(doms) {
var self = this;
this.length = 0;
this.name = "nicescrollarray";
this.each = function(fn) {
for (var a = 0, i = 0; a < self.length; a++) fn.call(self[a], i++);
return self;
};
this.push = function(nice) {
self[self.length] = nice;
self.length++;
};
this.eq = function(idx) {
return self[idx];
};
if (doms) {
for (var a = 0; a < doms.length; a++) {
var nice = $.data(doms[a], '__nicescroll') || false;
if (nice) {
this[this.length] = nice;
this.length++;
}
};
}
return this;
};
function mplex(el, lst, fn) {
for (var a = 0; a < lst.length; a++) fn(el, lst[a]);
};
mplex(
NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
function(e, n) {
e[n] = function() {
var args = arguments;
return this.each(function() {
this[n].apply(this, args);
});
};
}
);
jQuery.fn.getNiceScroll = function(index) {
if (typeof index == "undefined") {
return new NiceScrollArray(this);
} else {
var nice = this[index] && $.data(this[index], '__nicescroll') || false;
return nice;
}
};
jQuery.extend(jQuery.expr[':'], {
nicescroll: function(a) {
return ($.data(a, '__nicescroll')) ? true : false;
}
});
$.fn.niceScroll = function(wrapper, opt) {
if (typeof opt == "undefined") {
if ((typeof wrapper == "object") && !("jquery" in wrapper)) {
opt = wrapper;
wrapper = false;
}
}
var ret = new NiceScrollArray();
if (typeof opt == "undefined") opt = {};
if (wrapper || false) {
opt.doc = $(wrapper);
opt.win = $(this);
}
var docundef = !("doc" in opt);
if (!docundef && !("win" in opt)) opt.win = $(this);
this.each(function() {
var nice = $(this).data('__nicescroll') || false;
if (!nice) {
opt.doc = (docundef) ? $(this) : opt.doc;
nice = new NiceScrollClass(opt, $(this));
$(this).data('__nicescroll', nice);
}
ret.push(nice);
});
return (ret.length == 1) ? ret[0] : ret;
};
window.NiceScroll = {
getjQuery: function() {
return jQuery
}
};
if (!$.nicescroll) {
$.nicescroll = new NiceScrollArray();
$.nicescroll.options = _globaloptions;
}
}));